
CAS 942070-30-6
:Dihydro-4,4,5,5-tetramethyl-2-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thienyl]-1,3,2-dioxaborolane
Description:
Dihydro-4,4,5,5-tetramethyl-2-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thienyl]-1,3,2-dioxaborolane is a complex organic compound characterized by its unique structural features, including multiple dioxaborolane units and a thienyl group. This compound is notable for its potential applications in organic synthesis and materials science, particularly in the development of boron-containing compounds that can serve as intermediates in various chemical reactions. The presence of the dioxaborolane moiety suggests that it may exhibit interesting reactivity patterns, particularly in cross-coupling reactions, which are essential in the formation of carbon-carbon bonds. Additionally, the tetramethyl substituents contribute to its steric bulk, potentially influencing its solubility and reactivity. The compound's intricate structure may also impart specific electronic properties, making it a candidate for studies in organic electronics or photonics. Overall, this substance exemplifies the complexity and versatility of boron-containing organic compounds in modern chemistry.
Formula:C17H28B2O4S
InChI:InChI=1S/C17H28B2O4S/c1-11-12(18-20-14(2,3)15(4,5)21-18)10-13(24-11)19-22-16(6,7)17(8,9)23-19/h10H,1-9H3
InChI key:InChIKey=JGURGLQQJZHJNG-UHFFFAOYSA-N
SMILES:CC1=C(B2OC(C)(C)C(C)(C)O2)C=C(S1)B3OC(C)(C)C(C)(C)O3
Synonyms:- Dihydro-4,4,5,5-tetramethyl-2-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thienyl]-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, dihydro-4,4,5,5-tetramethyl-2-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thienyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2'-(5-METHYLTHIOPHENE-2,4-DIYL)BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE)
CAS:Formula:C17H28B2O4SMolecular weight:350.0888
