CymitQuimica logo

CAS 942070-70-4

:

2-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole

Description:
2-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole is a chemical compound characterized by its imidazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the 2-position and a methyl group at the 1-position contributes to its reactivity and solubility properties. The compound also features a boron-containing moiety, specifically a tetramethyl-1,3,2-dioxaborolane, which enhances its potential for applications in organic synthesis and medicinal chemistry. This dioxaborolane group is known for its ability to participate in various chemical reactions, including cross-coupling reactions, making the compound valuable in the development of pharmaceuticals and agrochemicals. The overall structure suggests that it may exhibit interesting electronic properties and biological activity, although specific biological data would require further investigation. Its unique combination of functional groups allows for diverse reactivity, making it a useful intermediate in synthetic organic chemistry.
Formula:C10H16BBrN2O2
InChI:InChI=1S/C10H16BBrN2O2/c1-9(2)10(3,4)16-11(15-9)7-6-13-8(12)14(7)5/h6H,1-5H3
InChI key:InChIKey=DKOZKKXDKGXMOI-UHFFFAOYSA-N
SMILES:CN1C(=CN=C1Br)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 2-(2-Bromo-1-methyl-1H-imidazol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 2-Bromo-1-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole
  • 2-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole
  • 1H-Imidazole, 2-bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.