CymitQuimica logo

CAS 942070-82-8

:

4-Bromo-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole

Description:
4-Bromo-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole is a chemical compound characterized by its unique structure, which includes an oxazole ring, a bromine substituent, and a boron-containing moiety. The presence of the oxazole ring imparts heterocyclic properties, making it potentially useful in various chemical reactions, particularly in organic synthesis and medicinal chemistry. The bromine atom enhances the compound's reactivity, allowing for further functionalization. The tetramethyl-1,3,2-dioxaborolane group contributes to the compound's stability and solubility, facilitating its use in cross-coupling reactions, such as Suzuki coupling, which is valuable in the synthesis of complex organic molecules. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in pharmaceutical applications. Overall, its distinctive characteristics make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C15H17BBrNO3
InChI:InChI=1S/C15H17BBrNO3/c1-14(2)15(3,4)21-16(20-14)11-12(17)18-13(19-11)10-8-6-5-7-9-10/h5-9H,1-4H3
InChI key:InChIKey=DXYVMWGYFKNIRQ-UHFFFAOYSA-N
SMILES:BrC1=C(OC(=N1)C2=CC=CC=C2)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • Oxazole, 4-bromo-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 4-Bromo-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.