CymitQuimica logo

CAS 942070-86-2

:

2-(4-Bromophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole

Description:
2-(4-Bromophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole, with the CAS number 942070-86-2, is an organic compound characterized by its unique structural features. It contains an oxazole ring, which is a five-membered heterocyclic compound featuring nitrogen and oxygen atoms, contributing to its potential biological activity. The presence of a bromophenyl group enhances its electronic properties and may influence its reactivity and solubility. Additionally, the incorporation of a dioxaborolane moiety introduces boron into the structure, which can facilitate various chemical transformations, including cross-coupling reactions commonly used in organic synthesis. This compound may exhibit interesting properties such as fluorescence or photostability, making it a candidate for applications in materials science or medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its behavior in different solvents and under various conditions would be of interest for further research and application development.
Formula:C15H17BBrNO3
InChI:InChI=1S/C15H17BBrNO3/c1-14(2)15(3,4)21-16(20-14)12-9-18-13(19-12)10-5-7-11(17)8-6-10/h5-9H,1-4H3
InChI key:InChIKey=KMACEXDUMBSSBA-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2OC(=NC2)C3=CC=C(Br)C=C3
Synonyms:
  • Oxazole, 2-(4-bromophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-(4-Bromophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.