CAS 942070-88-4
:4-bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole
Description:
4-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole is a chemical compound characterized by its unique structural features, including a pyrazole ring and a boron-containing dioxaborolane moiety. The presence of the bromine atom introduces a halogen substituent, which can influence the compound's reactivity and potential applications in organic synthesis or medicinal chemistry. The tetramethyl dioxaborolane group is notable for its ability to participate in various chemical reactions, particularly in the formation of boron-containing compounds, which are valuable in cross-coupling reactions and as intermediates in organic synthesis. This compound may exhibit specific physical properties such as solubility in organic solvents, and its stability can be influenced by the substituents on the pyrazole and boron moieties. Additionally, the presence of the methyl group on the pyrazole ring can affect its electronic properties and steric hindrance, potentially impacting its biological activity or utility in material science. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry.
Formula:C10H16BBrN2O2
InChI:InChI=1/C10H16BBrN2O2/c1-9(2)10(3,4)16-11(15-9)8-7(12)6-13-14(8)5/h6H,1-5H3
SMILES:CC1(C)C(C)(C)OB(c2c(cnn2C)Br)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:Formula:C10H16BBrN2O2Purity:97%Color and Shape:SolidMolecular weight:286.96124-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:4-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolePurity:97%Molecular weight:286.96g/mol4-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:Formula:C10H16BBrN2O2Purity:97%Molecular weight:286.964-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole
CAS:Controlled ProductFormula:C10H16BBrN2O2Color and Shape:NeatMolecular weight:286.9614-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:<p>4-Bromo-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a cytotoxic compound that belongs to the class of imidazoles. It has antiviral activity against some viruses such as herpes simplex virus and human immunodeficiency virus. 4-Bromo-1-methyl pyrazole is also an intermediate in the synthesis of anticancer drugs. This compound is functionalized with a pyrrazole group at C4 and is used for the synthesis of 2-[(4'-bromoimidazolinyl)methyl]pyridines.</p>Formula:C10H16BBrN2O2Purity:Min. 95%Molecular weight:286.97 g/mol




