CymitQuimica logo

CAS 94208-72-7

:

3-(Diphenylmethyl)pentanedinitrile

Description:
3-(Diphenylmethyl)pentanedinitrile, with the CAS number 94208-72-7, is an organic compound characterized by its structure, which includes a pentanedinitrile backbone with a diphenylmethyl group attached. This compound features two cyano (–C≡N) functional groups, which contribute to its reactivity and potential applications in organic synthesis and materials science. The presence of the diphenylmethyl group enhances its stability and may influence its solubility and interaction with other chemical species. Typically, compounds like this can exhibit properties such as moderate to high melting and boiling points, depending on their molecular weight and intermolecular forces. Additionally, the cyano groups can participate in various chemical reactions, making this compound a valuable intermediate in the synthesis of more complex molecules. Its unique structure may also impart specific optical or electronic properties, which could be of interest in fields such as pharmaceuticals or polymer chemistry. Safety data should be consulted for handling and storage, as nitriles can be toxic and require appropriate precautions.
Formula:C18H16N2
InChI:InChI=1/C18H16N2/c19-13-11-17(12-14-20)18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-18H,11-12H2
Synonyms:
  • 3-(Diphenylmethyl)pentanedinitrile
  • Pentanedinitrile, 3-(diphenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.