CAS 94212-15-4
:2-Hydroxycarbazole-3-carboxanilide
Description:
2-Hydroxycarbazole-3-carboxanilide, with the CAS number 94212-15-4, is an organic compound characterized by its structural features, which include a carbazole moiety, a hydroxyl group, and a carboxanilide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential interactions with biological systems due to its functional groups. The presence of the hydroxyl group suggests it may participate in hydrogen bonding, influencing its reactivity and solubility. Additionally, the carboxanilide structure can contribute to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. Its unique structure may also impart specific optical or electronic properties, making it of interest in materials science or pharmaceutical applications. Overall, 2-Hydroxycarbazole-3-carboxanilide is a compound that combines features of both aromatic and functionalized organic compounds, which may lead to diverse applications in various fields of chemistry.
Formula:C19H14N2O2
InChI:InChI=1/C19H14N2O2/c22-18-11-17-14(13-8-4-5-9-16(13)21-17)10-15(18)19(23)20-12-6-2-1-3-7-12/h1-11,21-22H,(H,20,23)
SMILES:c1ccc(cc1)N=C(c1cc2c3ccccc3[nH]c2cc1O)O
Synonyms:- 2-Hydroxy-N-phenyl-9H-carbazole-3-carboxamide
- Naphthol AS-BL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.