CAS 94213-25-9
:2-[Cyano(2,5-dichlorophenyl)methylene]hydrazinecarboximidamide
Description:
2-[Cyano(2,5-dichlorophenyl)methylene]hydrazinecarboximidamide, with the CAS number 94213-25-9, is a chemical compound characterized by its unique structure, which includes a hydrazinecarboximidamide moiety and a cyano group attached to a 2,5-dichlorophenyl ring. This compound typically exhibits properties associated with both hydrazine derivatives and cyano compounds, such as potential reactivity due to the presence of the cyano group, which can participate in nucleophilic addition reactions. The dichlorophenyl group may impart specific electronic and steric effects, influencing the compound's reactivity and solubility. Additionally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The presence of multiple functional groups suggests that it could engage in various chemical interactions, potentially leading to diverse applications in organic synthesis or medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for comprehensive characterization.
Formula:C9H7Cl2N5
InChI:InChI=1S/C9H7Cl2N5/c10-5-1-2-7(11)6(3-5)8(4-12)15-16-9(13)14/h1-3H,(H4,13,14,16)
InChI key:InChIKey=SDJPBBPBSADWBX-UHFFFAOYSA-N
SMILES:C(=NNC(=N)N)(C#N)C1=C(Cl)C=CC(Cl)=C1
Synonyms:- Hydrazinecarboximidamide, 2-[cyano(2,5-dichlorophenyl)methylene]-
- 2-[Cyano(2,5-dichlorophenyl)methylene]hydrazinecarboximidamide
- 3-(Cyano(2,5-dichlorophenyl)methylene)carbazamidine
- N''-[(E)-cyano(2,5-dichlorophenyl)methylidene]carbonohydrazonic diamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
