CymitQuimica logo

CAS 942189-65-3

:

2-(6-Bromopyridin-3-yl)pyrimidine

Description:
2-(6-Bromopyridin-3-yl)pyrimidine is a heterocyclic organic compound characterized by the presence of both pyridine and pyrimidine rings in its structure. The compound features a bromine atom substituted at the 6-position of the pyridine ring, which contributes to its chemical reactivity and potential biological activity. It typically exhibits moderate to high solubility in polar organic solvents due to the presence of nitrogen atoms in its rings, which can engage in hydrogen bonding. The compound may display interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure allows for various functionalization possibilities, which can enhance its activity or selectivity towards specific biological targets. Additionally, the presence of halogen substituents like bromine can influence the compound's electronic properties, potentially affecting its interactions with other molecules. Overall, 2-(6-Bromopyridin-3-yl)pyrimidine is a versatile compound with applications in research and development within the fields of chemistry and pharmacology.
Formula:C9H6BrN3
InChI:InChI=1S/C9H6BrN3/c10-8-3-2-7(6-13-8)9-11-4-1-5-12-9/h1-6H
InChI key:SYODETQANLEOFO-UHFFFAOYSA-N
SMILES:C1=CN=C(N=C1)C2=CN=C(C=C2)Br
Found 4 products.