CAS 942195-84-8
:N,N,2-Trimethyl-7-(phenylmethoxy)-1H-benzimidazole-5-carboxamide
Description:
N,N,2-Trimethyl-7-(phenylmethoxy)-1H-benzimidazole-5-carboxamide is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole core. This compound features a carboxamide functional group, contributing to its potential solubility in polar solvents. The presence of the trimethyl group and the phenylmethoxy substituent enhances its lipophilicity, which may influence its biological activity and interaction with various biological targets. The benzimidazole moiety is known for its pharmacological properties, often exhibiting antimicrobial, antifungal, and anticancer activities. The specific arrangement of substituents can affect the compound's reactivity, stability, and overall efficacy in medicinal chemistry applications. Additionally, the compound's CAS number, 942195-84-8, allows for precise identification and retrieval of information in chemical databases. Overall, this compound's unique structural features suggest potential utility in drug development and other chemical applications, although further studies would be necessary to fully elucidate its properties and biological effects.
Formula:C18H19N3O2
InChI:InChI=1S/C18H19N3O2/c1-12-19-15-9-14(18(22)21(2)3)10-16(17(15)20-12)23-11-13-7-5-4-6-8-13/h4-10H,11H2,1-3H3,(H,19,20)
InChI key:InChIKey=LMUKCLBCNXTYHK-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C3C(=CC(C(N(C)C)=O)=C2)N=C(C)N3
Synonyms:- 1H-Benzimidazole-5-carboxamide, N,N,2-trimethyl-7-(phenylmethoxy)-
- N,N,2-Trimethyl-7-(phenylmethoxy)-1H-benzimidazole-5-carboxamide
- N,N,2-Trimethyl-4-[(phenylmethyl)oxy]-1H-benzimidazole-6-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N,2-Trimethyl-4-[(phenylmethyl)oxy]-1H-benzimidazole-6-carboxamide
CAS:Controlled ProductFormula:C18H19N3O2Color and Shape:NeatMolecular weight:334.538
