CymitQuimica logo

CAS 94220-37-8

:

1,4-Dihydro-5-methyl-7H-pyrazolo[4,3-b]pyridin-7-one

Description:
1,4-Dihydro-5-methyl-7H-pyrazolo[4,3-b]pyridin-7-one, with the CAS number 94220-37-8, is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure. This compound features a fused ring system that includes both a pyrazole and a pyridine moiety, contributing to its unique chemical properties. It typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. The presence of the methyl group at the 5-position can influence its solubility and reactivity. In terms of physical properties, it may be a solid at room temperature, with potential for various applications in pharmaceuticals, particularly as a scaffold for developing new therapeutic agents. Its reactivity can be attributed to the presence of nitrogen atoms in the ring structure, which can participate in hydrogen bonding and coordination with metal ions. Overall, this compound represents a significant class of heterocycles with diverse applications in chemical research and development.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c1-4-2-6(11)7-5(9-4)3-8-10-7/h2-3H,1H3,(H,8,10)(H,9,11)
InChI key:InChIKey=JKOWWRNZIQCTCJ-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(C)=C1)C=NN2
Synonyms:
  • 7H-Pyrazolo[4,3-b]pyridin-7-one, 1,4-dihydro-5-methyl-
  • 1,4-Dihydro-5-methyl-7H-pyrazolo[4,3-b]pyridin-7-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.