CAS 94220-38-9

7-chloro-5-methyl-1H-pyrazolo[4,3-b]pyridine

Description:

7-Chloro-5-methyl-1H-pyrazolo[4,3-b]pyridine is a heterocyclic compound characterized by its fused pyrazole and pyridine rings. This compound features a chlorine atom at the 7-position and a methyl group at the 5-position of the pyrazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents, which is common for many heterocycles. The presence of the chlorine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for potential interactions with biological targets, which could lead to therapeutic applications. As with many heterocyclic compounds, it may also display interesting electronic properties due to the conjugated system within its ring structure. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.

Formula: C₇H₆ClN₃

InChI: InChI=1/C7H6ClN3/c1-4-2-5(8)7-6(10-4)3-9-11-7/h2-3H,1H3,(H,9,11)

SMILES: Cc1cc(c2c(cn[nH]2)n1)Cl

Synonyms:

• 1H-pyrazolo[4,3-b]pyridine, 7-chloro-5-methyl-
• 7-Chloro-5-methyl-1H-pyrazolo[4,3-b]pyridine

1H-​Pyrazolo[4,​3-​b]​pyridine, 7-​chloro-​5-​methyl-

CAS: 94220-38-9

Formula: C₇H₆ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 167.5956

Ref: IN-DA0065WA

7-Chloro-5-methyl-1H-pyrazolo[4,3-b]pyridine

CAS: 94220-38-9

7-Chloro-5-methyl-1H-pyrazolo[4,3-b]pyridine

Purity: 95%

Molecular weight: 167.60g/mol

Ref: 54-OR305333

7-Chloro-5-methyl-1H-pyrazolo[4,3-b]-pyridine

CAS: 94220-38-9

Formula: C₇H₆ClN₃

Purity: 97%

Color and Shape: No data available.

Molecular weight: 167.6

Ref: 10-F093200