CAS 94220-45-8

5-Chloro-1H-pyrazolo[4,3-b]pyridine

Description:

5-Chloro-1H-pyrazolo[4,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position of the pyrazole ring enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to off-white crystalline appearance and has a moderate molecular weight. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound's structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit biological activities, including antimicrobial or anti-inflammatory properties, although specific biological data may vary. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₄ClN₃

InChI: InChI=1/C6H4ClN3/c7-6-2-1-4-5(9-6)3-8-10-4/h1-3H,(H,8,10)

SMILES: c1cc(Cl)nc2c[nH]nc12

Synonyms:

• 1H-pyrazolo[4,3-b]pyridine, 5-chloro-

5-chloro-1h-pyrazolo[4,3-b]pyridine

CAS: 94220-45-8

Formula: C₆H₄ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.5691

Ref: IN-DA0036UL

5-Chloro-1H-pyrazolo[4,3-b]pyridine

CAS: 94220-45-8

5-Chloro-1H-pyrazolo[4,3-b]pyridine

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.56906g/mol

Ref: 54-OR301099

5-Chloro-1H-pyrazolo[4,3-b]pyridine

CAS: 94220-45-8

Formula: C₆H₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.57

Ref: 10-F049271