CAS 942206-06-6
:5-Bromo-2-(2-furanyl)pyridine
Description:
5-Bromo-2-(2-furanyl)pyridine is an organic compound characterized by its heterocyclic structure, which includes both a pyridine and a furan ring. The presence of a bromine atom at the 5-position of the pyridine ring enhances its reactivity and can influence its biological activity. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, making it suitable for various chemical reactions and applications. Its unique structure allows it to participate in diverse chemical transformations, including nucleophilic substitutions and coupling reactions. Additionally, compounds like 5-Bromo-2-(2-furanyl)pyridine are often studied for their potential pharmacological properties, as the combination of furan and pyridine rings can lead to interesting biological activities. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound represents a valuable building block in medicinal chemistry and materials science.
Formula:C9H6BrNO
InChI:InChI=1S/C9H6BrNO/c10-7-3-4-8(11-6-7)9-2-1-5-12-9/h1-6H
InChI key:InChIKey=ZKUDFBZRIQOMGO-UHFFFAOYSA-N
SMILES:BrC1=CC=C(N=C1)C2=CC=CO2
Synonyms:- Pyridine, 5-bromo-2-(2-furanyl)-
- 5-Bromo-2-(2-furanyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.