CAS 942206-09-9
:2-chloro-3-(2-fluoro-3-pyridyl)pyridine
Description:
2-Chloro-3-(2-fluoro-3-pyridyl)pyridine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing nitrogen. This compound features a chlorine atom at the 2-position and a 2-fluoro-3-pyridyl substituent at the 3-position of the pyridine ring. The presence of both chlorine and fluorine atoms introduces unique electronic and steric properties, making it of interest in various chemical applications, including medicinal chemistry and agrochemicals. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic nature of the pyridine rings, which can influence its solubility and permeability in biological systems. Additionally, the presence of halogen substituents can enhance its reactivity and potential interactions with biological targets. As with many pyridine derivatives, it may also exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as halogenated compounds can pose health risks.
Formula:C10H6ClFN2
InChI:InChI=1/C10H6ClFN2/c11-9-7(3-1-5-13-9)8-4-2-6-14-10(8)12/h1-6H
SMILES:c1cc(c2cccnc2F)c(Cl)nc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.