CymitQuimica logo

CAS 942206-10-2

:

5-Chloro-2′-fluoro-2,3′-bipyridine

Description:
5-Chloro-2′-fluoro-2,3′-bipyridine is a heterocyclic organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of chlorine and fluorine substituents at specific positions on the bipyridine framework significantly influences its chemical properties and reactivity. This compound typically exhibits a pale yellow to off-white solid appearance and is soluble in organic solvents. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The chlorine atom can enhance lipophilicity, while the fluorine atom may improve metabolic stability. Additionally, 5-Chloro-2′-fluoro-2,3′-bipyridine may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C10H6ClFN2
InChI:InChI=1S/C10H6ClFN2/c11-7-3-4-9(14-6-7)8-2-1-5-13-10(8)12/h1-6H
InChI key:InChIKey=SYJPQVCWWIZERQ-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC=C(Cl)C=N2)C=CC=N1
Synonyms:
  • 5-Chloro-2′-fluoro-2,3′-bipyridine
  • 2,3′-Bipyridine, 5-chloro-2′-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.