CAS 942206-11-3

5-Chloro-2′-fluoro-2,4′-bipyridine

Description:

5-Chloro-2′-fluoro-2,4′-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of chlorine and fluorine substituents at specific positions on the bipyridine framework significantly influences its chemical properties and reactivity. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure allows for potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science, particularly in the development of ligands for metal complexes or as intermediates in organic synthesis. The chlorine and fluorine atoms can enhance the compound's lipophilicity and stability, making it suitable for specific chemical reactions. Additionally, the compound's unique electronic properties may contribute to its utility in electronic materials or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₁₀H₆ClFN₂

InChI: InChI=1S/C10H6ClFN2/c11-8-1-2-9(14-6-8)7-3-4-13-10(12)5-7/h1-6H

InChI key: InChIKey=UCTHNJGQZMBIOJ-UHFFFAOYSA-N

SMILES: FC1=CC(=CC=N1)C2=CC=C(Cl)C=N2

Synonyms:

• 5-Chloro-2′-fluoro-2,4′-bipyridine
• 2,4′-Bipyridine, 5-chloro-2′-fluoro-