CAS 942206-16-8
:2-bromo-5-(2-bromo-4-pyridyl)pyridine
Description:
2-Bromo-5-(2-bromo-4-pyridyl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with bromine atoms and another pyridyl group. This compound typically exhibits properties associated with halogenated heterocycles, such as increased reactivity due to the presence of bromine, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of multiple bromine substituents can also influence its solubility and stability in different solvents. Additionally, the pyridine rings contribute to its potential as a ligand in coordination chemistry and its utility in organic synthesis. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 2-bromo-5-(2-bromo-4-pyridyl)pyridine is a versatile compound with applications in various fields of chemistry.
Formula:C10H6Br2N2
InChI:InChI=1/C10H6Br2N2/c11-9-2-1-8(6-14-9)7-3-4-13-10(12)5-7/h1-6H
SMILES:c1cc(Br)ncc1c1ccnc(c1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
