
CAS 942206-17-9
:6,6′-Dibromo-2,3′-bipyridine
Description:
6,6′-Dibromo-2,3′-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of bromine substituents at the 6 and 6′ positions enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish color and is known for its potential applications in organic synthesis, particularly in the development of ligands for metal complexes and in medicinal chemistry. Its molecular structure contributes to its electronic properties, making it a candidate for use in electronic materials and as a building block in the synthesis of more complex molecules. Additionally, the bromine atoms can participate in further chemical reactions, such as nucleophilic substitutions or coupling reactions, which are valuable in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as halogenated organic compounds can pose health risks and environmental concerns.
Formula:C10H6Br2N2
InChI:InChI=1S/C10H6Br2N2/c11-9-5-4-7(6-13-9)8-2-1-3-10(12)14-8/h1-6H
InChI key:InChIKey=PHHCZWMVSJDJKK-UHFFFAOYSA-N
SMILES:BrC1=NC(=CC=C1)C=2C=CC(Br)=NC2
Synonyms:- 2-Bromo-5-(6-bromopyridin-2-yl)pyridine
- 6,6′-Dibromo-2,3′-bipyridine
- 2,3′-Bipyridine, 6,6′-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

