
CAS 942206-24-8
:6,6′′-Dichloro-3,2′:4′,3′′-terpyridine
Description:
6,6′′-Dichloro-3,2′:4′,3′′-terpyridine is a synthetic organic compound characterized by its unique structure, which consists of three pyridine rings connected in a specific arrangement. The presence of two chlorine atoms at the 6 positions of the outer pyridine rings contributes to its chemical reactivity and potential applications in various fields, including materials science and medicinal chemistry. This compound typically exhibits properties such as solubility in organic solvents, and its electronic structure may allow for interesting photophysical properties, making it a candidate for use in organic electronics or as a ligand in coordination chemistry. Additionally, the dichloro substitution can influence its interaction with biological systems, potentially leading to applications in drug development or as a probe in biochemical assays. Overall, 6,6′′-Dichloro-3,2′:4′,3′′-terpyridine is notable for its structural complexity and versatility in chemical applications.
Formula:C15H9Cl2N3
InChI:InChI=1S/C15H9Cl2N3/c16-14-3-1-11(8-19-14)10-5-6-18-13(7-10)12-2-4-15(17)20-9-12/h1-9H
InChI key:InChIKey=CWMMDFDDGLQUBF-UHFFFAOYSA-N
SMILES:ClC=1C=CC(C=2C=C(N=CC2)C=3C=CC(Cl)=NC3)=CN1
Synonyms:- 3,2′:4′,3′′-Terpyridine, 6,6′′-dichloro-
- 2,4-Bis(6-chloropyridin-3-yl)pyridine
- 6,6′′-Dichloro-3,2′:4′,3′′-terpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.