CAS 94226-55-8
:methyl N,N-dibenzylglycinate
Description:
Methyl N,N-dibenzylglycinate is an organic compound characterized by its structure, which includes a methyl ester group and two benzyl substituents attached to the nitrogen of the glycine derivative. This compound typically appears as a white to off-white solid or a viscous liquid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic benzyl groups. Methyl N,N-dibenzylglycinate is known for its potential applications in medicinal chemistry, particularly in the synthesis of various pharmaceuticals and as an intermediate in organic synthesis. Its chemical properties include the ability to undergo hydrolysis, forming the corresponding glycine derivative and benzyl alcohols under appropriate conditions. Additionally, it may exhibit biological activity, making it of interest in research related to drug development. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with exposure.
Formula:C17H19NO2
InChI:InChI=1/C17H19NO2/c1-20-17(19)14-18(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11H,12-14H2,1H3
Synonyms:- glycine, N,N-bis(phenylmethyl)-, methyl ester
- Methyl N,N-dibenzylglycinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.