CymitQuimica logo

CAS 94230-87-2

:

7-Methoxy-3,7-dimethyl-3-octanol

Description:
7-Methoxy-3,7-dimethyl-3-octanol, identified by its CAS number 94230-87-2, is an organic compound characterized by its aliphatic structure featuring a long carbon chain with hydroxyl and methoxy functional groups. This compound typically exhibits a moderate to high boiling point due to the presence of the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The methoxy group contributes to its overall polarity and can influence its reactivity and interaction with other chemical species. As a tertiary alcohol, it may undergo typical alcohol reactions, such as oxidation or dehydration, depending on the reaction conditions. The presence of multiple methyl groups suggests that it may have a branched structure, which can affect its physical properties, such as viscosity and volatility. Additionally, this compound may have applications in fragrance formulations or as a potential intermediate in organic synthesis, although specific applications would depend on further research and development.
Formula:C11H24O2
InChI:InChI=1S/C11H24O2/c1-6-11(4,12)9-7-8-10(2,3)13-5/h12H,6-9H2,1-5H3
InChI key:InChIKey=GOQKULHUGPFFMU-UHFFFAOYSA-N
SMILES:C(CCCC(OC)(C)C)(CC)(C)O
Synonyms:
  • 3-Octanol, 7-methoxy-3,7-dimethyl-
  • 7-Methoxy-3,7-dimethyl-3-octanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.