CAS 94231-37-5
:L-Ornithine, ethyl ester, monohydrochloride
Description:
L-Ornithine, ethyl ester, monohydrochloride is a chemical compound derived from the amino acid ornithine, which plays a crucial role in the urea cycle and is involved in various metabolic processes. This compound is characterized by its ethyl ester form, which enhances its solubility and bioavailability compared to its parent amino acid. As a hydrochloride salt, it is typically more stable and easier to handle in laboratory and pharmaceutical applications. L-Ornithine, ethyl ester, monohydrochloride is often utilized in nutritional supplements and research related to muscle metabolism, growth hormone release, and recovery from exercise. It may also have potential applications in the treatment of certain metabolic disorders. The compound is generally considered safe when used appropriately, but like all substances, it should be handled with care, and its use should be guided by scientific research and regulatory standards. Its properties, such as melting point, solubility, and reactivity, can vary based on environmental conditions and formulation.
Formula:C7H16N2O2·ClH
InChI:InChI=1S/C7H16N2O2.ClH/c1-2-11-7(10)6(9)4-3-5-8;/h6H,2-5,8-9H2,1H3;1H/t6-;/m0./s1
InChI key:InChIKey=KTFGSLHRXVCGPI-RGMNGODLSA-N
SMILES:[C@@H](C(OCC)=O)(CCCN)N.Cl
Synonyms:- L-Ornithine, ethyl ester, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
