CAS 94231-64-8

3-(Hydroxymethyl)-1-piperidineethanol

Description:

3-(Hydroxymethyl)-1-piperidineethanol, with the CAS number 94231-64-8, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) and an ethanol moiety, contributing to its hydrophilic properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both hydroxyl and amine functional groups suggests that it can engage in hydrogen bonding, enhancing its solubility in polar solvents like water. This compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 3-(Hydroxymethyl)-1-piperidineethanol is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₈H₁₇NO₂

InChI: InChI=1S/C8H17NO2/c10-5-4-9-3-1-2-8(6-9)7-11/h8,10-11H,1-7H2

InChI key: InChIKey=VFSVQEBUBVGABB-UHFFFAOYSA-N

SMILES: C(CO)N1CC(CO)CCC1

Synonyms:

• 2-[3-(Hydroxymethyl)piperidin-1-yl]ethan-1-ol
• 1-Piperidineethanol, 3-(hydroxymethyl)-
• 2-(3-(Hydroxymethyl)piperidin-1-yl)ethanol
• 3-(Hydroxymethyl)-1-piperidineethanol