CAS 94231-87-5

L-Methionine, N-D-gluconoyl-

Description:

L-Methionine, N-D-gluconoyl- is a derivative of the amino acid L-methionine, which is an essential sulfur-containing amino acid important for various biological processes, including protein synthesis and as a precursor for other biomolecules. The "N-D-gluconoyl-" part indicates that a gluconoyl group is attached to the nitrogen of the methionine, which may influence its solubility, stability, and biological activity. This compound is typically characterized by its molecular structure, which includes both the methionine backbone and the gluconoyl moiety. It may exhibit properties such as being soluble in water and having potential applications in pharmaceuticals or nutritional supplements due to its amino acid content. Additionally, the presence of the gluconoyl group could enhance its bioavailability or modify its interaction with biological systems. As with many amino acid derivatives, it may also play a role in metabolic pathways or serve as a building block for more complex molecules. Further studies would be necessary to fully elucidate its specific characteristics and potential applications.

Formula: C₁₁H₂₁NO₈S

InChI: InChI=1S/C11H21NO8S/c1-21-3-2-5(11(19)20)12-10(18)9(17)8(16)7(15)6(14)4-13/h5-9,13-17H,2-4H2,1H3,(H,12,18)(H,19,20)/t5-,6+,7+,8-,9+/m0/s1

InChI key: InChIKey=IJIGIXPOPAELGH-JTPBWFLFSA-N

SMILES: [C@H](NC([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)=O)(CCSC)C(O)=O

Synonyms:

• N-D-Gluconoyl L-methionate
• L-Methionine, N-D-gluconoyl-

N-D-Gluconoyl-L-Methionate

CAS: 94231-87-5

Formula: C₁₁H₂₁NO₈S

Molecular weight: 327.35

Ref: 4Z-G-336

N-D-Gluconoyl-L-methionine

Controlled Product

CAS: 94231-87-5

Applications N-D-Gluconoyl-L-methionine is used in preparation of stabilized Sulfur containing Amino Acids and their derivatives.
References Kinoshita, Y., et al.: pn. Kokai Tokkyo Koho, (2001);

Formula: C₁₁H₂₁NO₈S

Color and Shape: Neat

Molecular weight: 327.35

Ref: TR-G942310