CAS 94232-67-4
:4-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)-α-ethylbenzeneacetic acid
Description:
4-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)-α-ethylbenzeneacetic acid, with the CAS number 94232-67-4, is a chemical compound that features a complex structure characterized by an isoindole moiety and an ethylbenzeneacetic acid functional group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which may influence its solubility, reactivity, and potential biological activity. The presence of the dioxo group suggests potential for hydrogen bonding and reactivity in various chemical environments. Its molecular structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility in different solvents would depend on its specific molecular interactions and the presence of functional groups. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or as a chemical intermediate in organic synthesis.
Formula:C18H15NO4
InChI:InChI=1S/C18H15NO4/c1-2-13(18(22)23)11-7-9-12(10-8-11)19-16(20)14-5-3-4-6-15(14)17(19)21/h3-10,13H,2H2,1H3,(H,22,23)
InChI key:InChIKey=ZQKLRJAOOUMVSA-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)C=2C1=CC=CC2)C3=CC=C(C(C(O)=O)CC)C=C3
Synonyms:- 2-(p-Phthalimidophenyl)butyric acid
- 2-[4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)phenyl]butanoic acid
- 4-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)-α-ethylbenzeneacetic acid
- Benzeneacetic acid, 4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-α-ethyl-
- 2-(4-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl)butyric acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
