CAS 942399-20-4

2-Amino-2-[2-[4-(heptyloxy)-3-(trifluoromethyl)phenyl]ethyl]-1,3-propanediol

Description:

2-Amino-2-[2-[4-(heptyloxy)-3-(trifluoromethyl)phenyl]ethyl]-1,3-propanediol, with CAS number 942399-20-4, is a synthetic organic compound characterized by its complex structure that includes an amino group, a propanediol backbone, and a phenyl ring substituted with a heptyloxy group and a trifluoromethyl group. This compound is likely to exhibit properties typical of amphiphilic molecules due to the presence of both hydrophilic (the amino and hydroxyl groups) and hydrophobic (the heptyloxy chain) components. Such characteristics may contribute to its potential applications in fields like pharmaceuticals, where it could serve as a drug delivery agent or in the formulation of surfactants. The trifluoromethyl group may enhance lipophilicity and influence the compound's biological activity. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, making it a versatile compound in organic synthesis. Its stability, solubility, and reactivity would depend on the specific conditions under which it is used.

Formula: C₁₉H₃₀F₃NO₃

InChI: InChI=1S/C19H30F3NO3/c1-2-3-4-5-6-11-26-17-8-7-15(12-16(17)19(20,21)22)9-10-18(23,13-24)14-25/h7-8,12,24-25H,2-6,9-11,13-14,23H2,1H3

InChI key: InChIKey=JVCPIJKPAKAIIP-UHFFFAOYSA-N

SMILES: O(CCCCCCC)C1=C(C(F)(F)F)C=C(CCC(CO)(CO)N)C=C1

Synonyms:

• Amiselimod
• 2-Amino-2-[2-[4-(heptyloxy)-3-(trifluoromethyl)phenyl]ethyl]-1,3-propanediol
• 2-Amino-2-[2-(4-heptyloxy-3-trifluoromethylphenyl)ethyl]propane-1,3-diol
• 1,3-Propanediol, 2-amino-2-[2-[4-(heptyloxy)-3-(trifluoromethyl)phenyl]ethyl]-
• 2-Amino-2-[2-[4-heptoxy-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol