CymitQuimica logo

CAS 942400-34-2

:

rel-(2R,6S)-4-(3-Azetidinyl)-2,6-dimethylmorpholine

Description:
Rel-(2R,6S)-4-(3-Azetidinyl)-2,6-dimethylmorpholine is a chemical compound characterized by its morpholine structure, which includes a six-membered ring containing both nitrogen and oxygen atoms. The specific stereochemistry indicated by the "rel-(2R,6S)" notation suggests that the compound has specific spatial arrangements of its substituents, which can significantly influence its biological activity and interactions. The presence of the azetidine group contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry. This compound may exhibit properties such as solubility in organic solvents and potential interactions with biological targets, which are essential for its application in drug development. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, impacting its stability and reactivity. As with many morpholine derivatives, it may have applications in various fields, including pharmaceuticals, agrochemicals, and materials science, depending on its specific properties and biological activity.
Formula:C9H18N2O
InChI:InChI=1/C9H18N2O/c1-7-5-11(6-8(2)12-7)9-3-10-4-9/h7-10H,3-6H2,1-2H3/t7-,8+
InChI key:InChIKey=VZBSAVYBLCLTAS-OCAPTIKFNA-N
SMILES:C[C@H]1CN(C[C@@H](C)O1)C2CNC2
Synonyms:
  • Morpholine, 4-(3-azetidinyl)-2,6-dimethyl-, (2R,6S)-rel-
  • rel-(2R,6S)-4-(3-Azetidinyl)-2,6-dimethylmorpholine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.