CAS 94242-49-6
:N-cyclopropyl-2,3,4-trifluoroaniline
Description:
N-cyclopropyl-2,3,4-trifluoroaniline is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a trifluoro-substituted aniline moiety. The presence of the trifluoromethyl groups at the 2, 3, and 4 positions on the aromatic ring significantly influences its chemical properties, including increased electronegativity and potential for hydrogen bonding. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. Its trifluoromethyl groups enhance its lipophilicity, making it of interest in medicinal chemistry and materials science. The cyclopropyl group contributes to the compound's strain and reactivity, potentially affecting its interaction with biological targets. Additionally, N-cyclopropyl-2,3,4-trifluoroaniline may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper safety protocols are followed.
Formula:C9H8F3N
InChI:InChI=1/C9H8F3N/c10-6-3-4-7(9(12)8(6)11)13-5-1-2-5/h3-5,13H,1-2H2
SMILES:C1CC1Nc1ccc(c(c1F)F)F
Synonyms:- 94242-49-6
- Benzenamine, N-cyclopropyl-2,3,4-trifluoro-
- L3Tj Amr Bf Cf Df
- N-Cyclopropyl-2,3,4-trifluorobenzenamine
- N-Cyclopropyl-2,3,4-trifluoroaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.