CAS 94242-51-0
:3-Quinolinecarboxylic acid,1-cyclopropyl-6,7,8-trifluoro-1,4-dihydro-4-oxo-, ethyl ester
Description:
3-Quinolinecarboxylic acid, 1-cyclopropyl-6,7,8-trifluoro-1,4-dihydro-4-oxo-, ethyl ester is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This specific compound features a cyclopropyl group and trifluoromethyl substituents, which contribute to its unique chemical properties and potential biological activity. The presence of the ethyl ester functional group indicates that it can undergo hydrolysis to form the corresponding carboxylic acid. The trifluoro substituents can enhance lipophilicity and influence the compound's interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. However, detailed studies on its toxicity, efficacy, and mechanism of action would be necessary to fully understand its potential uses. As with many fluorinated compounds, it may also exhibit unique stability and reactivity characteristics due to the presence of fluorine atoms.
Formula:C15H12F3NO3
InChI:InChI=1S/C15H12F3NO3/c1-2-22-15(21)9-6-19(7-3-4-7)13-8(14(9)20)5-10(16)11(17)12(13)18/h5-7H,2-4H2,1H3
InChI key:InChIKey=FGICMAMEHORFNK-UHFFFAOYSA-N
SMILES:FC1=C2N(C=C(C(OCC)=O)C(=O)C2=CC(F)=C1F)C3CC3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Moxifloxacin Impurity 17
CAS:Formula:C15H12F3NO3Color and Shape:White To Off-White SolidMolecular weight:311.261-Cyclopropyl-6,7,8-trifluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic Acid Ethyl Ester
CAS:Applications Intermediate in the preparation of Moxifloxacin derivatives.
References Zhang, Z., et al.: Bioorg. Med. Chem. Lett., 14, 393 (2004), Zhang, Z., et al.: Bioorg. Med. Chem., 15, 7274 (2007),Formula:C15H12F3NO3Color and Shape:NeatMolecular weight:311.2559


