CAS 94242-53-2
:1-cyclopropyl-6,8-difluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid
Description:
1-Cyclopropyl-6,8-difluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid is a synthetic compound belonging to the class of quinolines, which are bicyclic aromatic compounds. This substance features a cyclopropyl group, two fluorine atoms, and a piperazine moiety, contributing to its unique chemical properties and potential biological activity. The presence of the carboxylic acid functional group suggests that it may exhibit acidic behavior, influencing its solubility and reactivity in various environments. The difluoro substitution can enhance lipophilicity and may affect the compound's interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential antimicrobial or antiviral properties, as quinoline derivatives are often explored for their pharmacological activities. Its structural complexity and functional groups may also allow for diverse modifications, potentially leading to the development of novel therapeutic agents. As with many synthetic compounds, understanding its stability, reactivity, and biological interactions is crucial for its application in research and medicine.
Formula:C17H17F2N3O3
InChI:InChI=1/C17H17F2N3O3/c18-12-7-10-14(13(19)15(12)21-5-3-20-4-6-21)22(9-1-2-9)8-11(16(10)23)17(24)25/h7-9,20H,1-6H2,(H,24,25)
InChI key:InChIKey=CZXWNPNFWRABAP-UHFFFAOYSA-N
SMILES:C1CC1n1cc(c(=O)c2cc(c(c(c12)F)N1CCNCC1)F)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.