CAS 94243-23-9

1-(3-Methyl-1,2,4-triazin-5-yl)ethanone

Description:

1-(3-Methyl-1,2,4-triazin-5-yl)ethanone, with the CAS number 94243-23-9, is an organic compound characterized by its triazine ring structure, which contributes to its unique chemical properties. This compound features a ketone functional group (ethanone) attached to a triazine moiety, specifically at the 5-position of the triazine ring. The presence of the methyl group at the 3-position enhances its reactivity and solubility in various organic solvents. Typically, compounds of this nature exhibit moderate stability under standard conditions but may undergo reactions such as nucleophilic substitution or condensation, particularly in the presence of strong nucleophiles. The triazine ring is known for its ability to participate in coordination chemistry, potentially forming complexes with metal ions. Additionally, this compound may exhibit biological activity, making it of interest in fields such as agrochemicals or pharmaceuticals. Its specific applications and behavior would depend on further studies and context regarding its interactions and stability under various conditions.

Formula: C₆H₇N₃O

InChI: InChI=1S/C6H7N3O/c1-4(10)6-3-7-9-5(2)8-6/h3H,1-2H3

InChI key: InChIKey=UJPXJGIEIYRBJC-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=NC(C)=NN=C1

Synonyms:

• 1-(3-Methyl-1,2,4-triazin-5-yl)ethanone
• 1-(3-Methyl-1,2,4-triazin-5-yl)ethan-1-one
• Ethanone, 1-(3-methyl-1,2,4-triazin-5-yl)-