CAS 942435-50-9
:5-Hexyl-5'-vinyl-2,2'-bithiophene
Description:
5-Hexyl-5'-vinyl-2,2'-bithiophene is an organic compound belonging to the class of bithiophenes, which are characterized by their two thiophene rings connected by a single bond. This particular compound features a hexyl group and a vinyl group attached to the bithiophene structure, enhancing its solubility and electronic properties. It typically exhibits good thermal stability and can be used in various applications, including organic electronics, such as organic photovoltaics and field-effect transistors, due to its semiconducting properties. The presence of the hexyl chain contributes to its solubility in organic solvents, while the vinyl group can facilitate polymerization reactions, making it a potential precursor for conducting polymers. Additionally, the compound's conjugated system allows for effective π-π stacking, which is beneficial for charge transport in electronic devices. Overall, 5-Hexyl-5'-vinyl-2,2'-bithiophene is of interest in materials science and organic chemistry for its unique structural features and potential applications in advanced technologies.
Formula:C16H20S2
InChI:InChI=1S/C16H20S2/c1-3-5-6-7-8-14-10-12-16(18-14)15-11-9-13(4-2)17-15/h4,9-12H,2-3,5-8H2,1H3
Synonyms:- K0313
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
