CymitQuimica logo

CAS 942473-59-8

:

2,5-dibromopyridine-4-carboxylic acid

Description:
2,5-Dibromopyridine-4-carboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with two bromine atoms and a carboxylic acid group. The compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and reactivity. The bromine substituents at the 2 and 5 positions enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The carboxylic acid group at the 4 position introduces acidic properties, allowing for potential interactions with bases and facilitating the formation of salts or esters. This compound is of interest in synthetic organic chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, 2,5-dibromopyridine-4-carboxylic acid is a versatile compound with applications in various fields of chemistry.
Formula:C6H3Br2NO2
InChI:InChI=1/C6H3Br2NO2/c7-4-2-9-5(8)1-3(4)6(10)11/h1-2H,(H,10,11)
InChI key:CLIZDLYBXIPXCR-UHFFFAOYSA-N
SMILES:c1c(c(cnc1Br)Br)C(=O)O
Synonyms:
  • 2,5-Dibromoisonicotinic acid
  • 2,5-Dibromo-isonicotinicacid
  • 4-Pyridinecarboxylic acid, 2,5-dibromo-
Found 4 products.