CymitQuimica logo

CAS 942473-77-0

:

3-[(4-Bromophenyl)thio]-1-(diphenylmethyl)azetidine

Description:
3-[(4-Bromophenyl)thio]-1-(diphenylmethyl)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a thioether group, specifically a phenyl ring substituted with a bromine atom, contributes to its unique reactivity and potential biological activity. The diphenylmethyl group enhances the compound's lipophilicity, which may influence its pharmacokinetic properties. This compound may exhibit interesting interactions due to the electron-withdrawing nature of the bromine atom and the steric effects of the bulky diphenylmethyl substituent. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including nucleophilic substitution and possibly coupling reactions. As with many organic compounds, safety and handling precautions should be observed due to the presence of bromine and potential toxicity associated with thioether compounds.
Formula:C22H20BrNS
InChI:InChI=1S/C22H20BrNS/c23-19-11-13-20(14-12-19)25-21-15-24(16-21)22(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,21-22H,15-16H2
InChI key:InChIKey=AYSRARHJXLHJQP-UHFFFAOYSA-N
SMILES:C(N1CC(SC2=CC=C(Br)C=C2)C1)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:
  • Azetidine, 3-[(4-bromophenyl)thio]-1-(diphenylmethyl)-
  • 3-[(4-Bromophenyl)thio]-1-(diphenylmethyl)azetidine
  • 1-Benzhydryl-3-(4-bromo-phenylthio)-azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.