CAS 942473-91-8
:4-Chloro-7-fluoro-2-benzothiazolamine
Description:
4-Chloro-7-fluoro-2-benzothiazolamine is a chemical compound characterized by its unique structure, which includes a benzothiazole ring substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with heterocyclic aromatic amines, including potential biological activity. The presence of the chloro and fluoro substituents can influence its reactivity, solubility, and interaction with biological systems. It may be utilized in various applications, including pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The benzothiazole moiety is known for its role in medicinal chemistry, often associated with antimicrobial, anti-inflammatory, and anticancer properties. As with many chemical substances, safety and handling precautions are essential, as it may pose health risks or environmental hazards. Proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in research and industrial applications.
Formula:C7H4ClFN2S
InChI:InChI=1S/C7H4ClFN2S/c8-3-1-2-4(9)6-5(3)11-7(10)12-6/h1-2H,(H2,10,11)
InChI key:InChIKey=NJNFNLUVAPOZML-UHFFFAOYSA-N
SMILES:ClC1=C2C(SC(N)=N2)=C(F)C=C1
Synonyms:- 4-Chloro-7-fluoro-2-benzothiazolamine
- 2-Benzothiazolamine, 4-chloro-7-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
