CAS 942473-95-2

4,6,7-Trifluoro-2-benzothiazolamine

Description:

4,6,7-Trifluoro-2-benzothiazolamine is a chemical compound characterized by its unique structure, which includes a benzothiazole ring fused with an amine group and three fluorine atoms at the 4, 6, and 7 positions. This compound is notable for its potential applications in pharmaceuticals and agrochemicals due to the presence of the fluorine atoms, which can enhance biological activity and lipophilicity. The benzothiazole moiety is known for its role in various biological activities, including antimicrobial and anticancer properties. The trifluoromethyl groups can influence the compound's reactivity and stability, making it an interesting subject for research in medicinal chemistry. Additionally, the compound's solubility, melting point, and other physical properties would be influenced by its molecular structure and the presence of electronegative fluorine atoms. Safety and handling considerations are essential, as with many fluorinated compounds, due to potential toxicity and environmental impact. Overall, 4,6,7-Trifluoro-2-benzothiazolamine represents a significant area of interest in chemical research and development.

Formula: C₇H₃F₃N₂S

InChI: InChI=1S/C7H3F3N2S/c8-2-1-3(9)5-6(4(2)10)13-7(11)12-5/h1H,(H2,11,12)

InChI key: InChIKey=MDXPZGBVQCYUTM-UHFFFAOYSA-N

SMILES: FC1=C2C(=C(F)C=C1F)N=C(N)S2

Synonyms:

• 4,6,7-Trifluoro-2-benzothiazolamine
• 2-Benzothiazolamine, 4,6,7-trifluoro-