CAS 942474-30-8
:1-[4-(Ethylsulfonyl)-2-nitrophenyl]-4-piperidinecarboxamide
Description:
1-[4-(Ethylsulfonyl)-2-nitrophenyl]-4-piperidinecarboxamide, identified by its CAS number 942474-30-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring and functional groups such as a sulfonyl and nitro group. This compound typically exhibits properties associated with both its aromatic and aliphatic components, including potential solubility in polar solvents due to the presence of the sulfonyl group. The nitro group may impart specific reactivity, making it a candidate for various chemical reactions. Additionally, the piperidine moiety can influence biological activity, often contributing to pharmacological properties. Such compounds are of interest in medicinal chemistry, particularly for their potential therapeutic applications. The presence of the ethylsulfonyl group suggests possible interactions with biological targets, enhancing the compound's efficacy in specific contexts. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C14H19N3O5S
InChI:InChI=1S/C14H19N3O5S/c1-2-23(21,22)11-3-4-12(13(9-11)17(19)20)16-7-5-10(6-8-16)14(15)18/h3-4,9-10H,2,5-8H2,1H3,(H2,15,18)
InChI key:InChIKey=NZONRQLTLIJHJY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC(S(CC)(=O)=O)=C1)N2CCC(C(N)=O)CC2
Synonyms:- 4-Piperidinecarboxamide, 1-[4-(ethylsulfonyl)-2-nitrophenyl]-
- 1-[4-(Ethylsulfonyl)-2-nitrophenyl]-4-piperidinecarboxamide
- 1-[4-(ETHYLSULFONYL)-2-NITROPHENYL]PIPERIDINE-4-CARBOXAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-[4-(Ethylsulphonyl)-2-nitrophenyl]piperidine-4-carboxamide
CAS:<p>1-[4-(Ethylsulphonyl)-2-nitrophenyl]piperidine-4-carboxamide</p>Molecular weight:341.38g/mol1-[4-(Ethylsulfonyl)-2-nitrophenyl]piperidine-4-carboxamide
CAS:Formula:C14H19N3O5SMolecular weight:341.38

