CAS 942474-55-7
:1-(4-Carboxy-2-nitrophenyl)-4-piperidinecarboxylic acid
Description:
1-(4-Carboxy-2-nitrophenyl)-4-piperidinecarboxylic acid, with the CAS number 942474-55-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring and functional groups such as carboxylic acid and nitro groups. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various solvents. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the nitro group may impart electrophilic characteristics, making it a candidate for further chemical modifications. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of such compounds to interact with biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a unique combination of functional groups that may offer diverse applications in chemical research and development.
Formula:C13H14N2O6
InChI:InChI=1S/C13H14N2O6/c16-12(17)8-3-5-14(6-4-8)10-2-1-9(13(18)19)7-11(10)15(20)21/h1-2,7-8H,3-6H2,(H,16,17)(H,18,19)
InChI key:InChIKey=DGUKSCGEXKTNIL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC(C(O)=O)=C1)N2CCC(C(O)=O)CC2
Synonyms:- 4-Piperidinecarboxylic acid, 1-(4-carboxy-2-nitrophenyl)-
- 1-(4-Carboxy-2-nitrophenyl)-4-piperidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.