CAS 942474-60-4

Ethyl 4-[4-(aminocarbonyl)-1-piperidinyl]-3-nitrobenzoate

Description:

Ethyl 4-[4-(aminocarbonyl)-1-piperidinyl]-3-nitrobenzoate, identified by its CAS number 942474-60-4, is a chemical compound characterized by its complex structure, which includes an ethyl ester group, a nitro group, and a piperidine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the nitro group suggests it may participate in electrophilic reactions, while the piperidine moiety can influence its solubility and interaction with biological targets. The aminocarbonyl group indicates the presence of an amide functionality, which can enhance hydrogen bonding capabilities. Such structural features may render the compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its synthesis and reactivity can be influenced by various factors, including pH and solvent conditions, making it a versatile compound for research applications. Overall, this substance may hold promise in therapeutic contexts, although specific biological activities would require further investigation.

Formula: C₁₅H₁₉N₃O₅

InChI: InChI=1S/C15H19N3O5/c1-2-23-15(20)11-3-4-12(13(9-11)18(21)22)17-7-5-10(6-8-17)14(16)19/h3-4,9-10H,2,5-8H2,1H3,(H2,16,19)

InChI key: InChIKey=ADEPOMVYKKOHQI-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=CC(C(OCC)=O)=C1)N2CCC(C(N)=O)CC2

Synonyms:

• Benzoic acid, 4-[4-(aminocarbonyl)-1-piperidinyl]-3-nitro-, ethyl ester
• Ethyl 4-[4-(aminocarbonyl)-1-piperidinyl]-3-nitrobenzoate

Ethyl 3-nitro-4-(piperidin-4-carboxamide-1-yl)benzoate

CAS: 942474-60-4

Ethyl 3-nitro-4-(piperidin-4-carboxamide-1-yl)benzoate

Purity: ≥95%

Ref: 54-OR8203