
CAS 942474-88-6
:4-Ethyl 1-(2-carboxy-6-nitrophenyl)-4-piperidinecarboxylate
Description:
4-Ethyl 1-(2-carboxy-6-nitrophenyl)-4-piperidinecarboxylate, identified by its CAS number 942474-88-6, is a chemical compound that features a piperidine ring substituted with both an ethyl group and a carboxylate moiety. The presence of a nitrophenyl group indicates that the compound has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the nitro group's electron-withdrawing properties, which can influence the compound's reactivity and biological activity. The carboxylic acid functionality suggests that it may participate in various chemical reactions, such as esterification or amidation. Additionally, the compound's structure implies it may exhibit specific solubility characteristics, likely being soluble in polar solvents due to the presence of the carboxylate group. Its molecular structure may also suggest potential interactions with biological targets, making it of interest for further research in drug design and development. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical and pharmaceutical applications.
Formula:C15H18N2O6
InChI:InChI=1S/C15H18N2O6/c1-2-23-15(20)10-6-8-16(9-7-10)13-11(14(18)19)4-3-5-12(13)17(21)22/h3-5,10H,2,6-9H2,1H3,(H,18,19)
InChI key:InChIKey=ZFWVQQDYVKGWJS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(N(=O)=O)=CC=C1)N2CCC(C(OCC)=O)CC2
Synonyms:- 4-Piperidinecarboxylic acid, 1-(2-carboxy-6-nitrophenyl)-, 4-ethyl ester
- 4-Ethyl 1-(2-carboxy-6-nitrophenyl)-4-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.