CAS 942475-03-8

Methyl 3,5-dimethoxy-β-oxobenzenebutanoate

Description:

Methyl 3,5-dimethoxy-β-oxobenzenebutanoate is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two methoxy groups and a β-oxobutanoate moiety. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of methoxy groups enhances its electron-donating characteristics, which can influence its reactivity and interactions in chemical reactions. The β-oxobutanoate portion suggests potential for keto-enol tautomerism, which can affect its stability and reactivity. Methyl 3,5-dimethoxy-β-oxobenzenebutanoate may also exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific applications and behavior in various chemical environments would depend on further empirical studies, including its synthesis, stability under different conditions, and potential interactions with other chemical species. Overall, this compound represents a unique structure that could have diverse applications in organic synthesis and drug development.

Formula: C₁₃H₁₆O₅

InChI: InChI=1S/C13H16O5/c1-16-11-5-9(6-12(8-11)17-2)4-10(14)7-13(15)18-3/h5-6,8H,4,7H2,1-3H3

InChI key: InChIKey=GWQWSTKILKABHU-UHFFFAOYSA-N

SMILES: C(C(CC(OC)=O)=O)C1=CC(OC)=CC(OC)=C1

Synonyms:

• Methyl 3,5-dimethoxy-β-oxobenzenebutanoate
• Benzenebutanoic acid, 3,5-dimethoxy-β-oxo-, methyl ester