CAS 942475-07-2

4′-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid

Description:

4′-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at one end of the biphenyl moiety imparts acidic properties to the compound. The trifluoromethyl group (-CF3) and the fluoro group (-F) are notable substituents that enhance the compound's lipophilicity and influence its electronic properties, potentially affecting its reactivity and interactions in various chemical environments. This compound may exhibit unique characteristics such as increased stability and altered solubility due to the presence of these fluorinated groups. Additionally, its structural features suggest potential applications in pharmaceuticals, agrochemicals, or materials science, where fluorinated compounds are often valued for their distinctive properties. As with many fluorinated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.

Formula: C₁₄H₈F₄O₂

InChI: InChI=1S/C14H8F4O2/c15-12-6-5-10(7-11(12)14(16,17)18)8-1-3-9(4-2-8)13(19)20/h1-7H,(H,19,20)

InChI key: InChIKey=WBIJBBBOHSRCAK-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1F)C2=CC=C(C(O)=O)C=C2

Synonyms:

• 4′-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 4′-fluoro-3′-(trifluoromethyl)-

4-(4-Fluoro-3-trifluoromethylphenyl)benzoic acid

CAS: 942475-07-2

Formula: C₁₄H₈F₄O₂

Molecular weight: 284.2057

Ref: IN-DA00II0A