CAS 942475-08-3

2-(3-Chlorophenyl)-6-methoxynaphthalene

Description:

2-(3-Chlorophenyl)-6-methoxynaphthalene, identified by its CAS number 942475-08-3, is an organic compound characterized by its naphthalene backbone substituted with a methoxy group and a chlorophenyl group. This compound typically exhibits a solid state at room temperature and is likely to be non-polar due to the presence of aromatic rings, which can influence its solubility in organic solvents. The methoxy group (-OCH3) contributes to its electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. The chlorophenyl substituent introduces a chlorine atom, which can affect the compound's overall polarity and reactivity, as well as its potential biological activity. The presence of these functional groups suggests that the compound may have applications in organic synthesis, pharmaceuticals, or materials science. Additionally, its structural features may allow for interesting interactions in biological systems, warranting further investigation into its properties and potential uses. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact.

Formula: C₁₇H₁₃ClO

InChI: InChI=1S/C17H13ClO/c1-19-17-8-7-14-9-13(5-6-15(14)11-17)12-3-2-4-16(18)10-12/h2-11H,1H3

InChI key: InChIKey=KOSJRNXKSWBQAQ-UHFFFAOYSA-N

SMILES: O(C)C1=CC2=C(C=C(C=C2)C3=CC(Cl)=CC=C3)C=C1

Synonyms:

• 2-(3-Chlorophenyl)-6-methoxynaphthalene
• Naphthalene, 2-(3-chlorophenyl)-6-methoxy-