CAS 94248-93-8

5-Chloro-2-(4-chlorophenoxy)-N,N-diethylbenzenamine

Description:

5-Chloro-2-(4-chlorophenoxy)-N,N-diethylbenzenamine, with the CAS number 94248-93-8, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with chlorine and a diethylamino group. This compound features a chlorophenoxy moiety, indicating the presence of a phenyl ether linkage, which can influence its solubility and reactivity. The presence of chlorine atoms enhances its potential for biological activity, possibly contributing to its use in various applications, including as a pesticide or herbicide. The diethylamino group suggests that the compound may exhibit basic properties, which can affect its interaction with biological systems. Additionally, the compound's molecular structure may impart specific physical properties such as melting and boiling points, solubility in organic solvents, and stability under various conditions. Overall, the characteristics of this compound make it of interest in both industrial and research contexts, particularly in the fields of agrochemicals and medicinal chemistry.

Formula: C₁₆H₁₇Cl₂NO

InChI: InChI=1/C16H17Cl2NO/c1-3-19(4-2)15-11-13(18)7-10-16(15)20-14-8-5-12(17)6-9-14/h5-11H,3-4H2,1-2H3

InChI key: InChIKey=NHKAINUQCSTXKV-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1=C(OC2=CC=C(Cl)C=C2)C=CC(Cl)=C1

Synonyms:

• Benzenamine, 5-chloro-2-(4-chlorophenoxy)-N,N-diethyl-
• 5-Chloro-2-(4-chlorophenoxy)-N,N-diethylbenzenamine
• 5-Chloro-2-(4-chlorophenoxy)-N,N-diethylaniline