CAS 942492-11-7

1,1-Dimethylethyl 6-amino-1,2,3,4-tetrahydronaphthalen-1,4-imine-9-carboxylate

Description:

1,1-Dimethylethyl 6-amino-1,2,3,4-tetrahydronaphthalen-1,4-imine-9-carboxylate, with the CAS number 942492-11-7, is a chemical compound that features a complex structure characterized by a tetrahydronaphthalene core. This compound contains an imine functional group, which is indicative of a carbon-nitrogen double bond, and a carboxylate group, suggesting it has acidic properties. The presence of the dimethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with other molecules. The amino group indicates that it can participate in hydrogen bonding, which may affect its solubility and biological activity. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design or as a potential therapeutic agent. Its specific properties, such as solubility, melting point, and reactivity, would need to be determined through experimental methods, as they can vary based on environmental conditions and the presence of other substances.

Formula: C₁₅H₂₀N₂O₂

InChI: InChI=1S/C15H20N2O2/c1-15(2,3)19-14(18)17-12-6-7-13(17)11-8-9(16)4-5-10(11)12/h4-5,8,12-13H,6-7,16H2,1-3H3

InChI key: InChIKey=RGNQFMYCOUARHV-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C2C=3C(C1CC2)=CC(N)=CC3

Synonyms:

• Naphthalen-1,4-imine-9-carboxylic acid, 6-amino-1,2,3,4-tetrahydro-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 6-amino-1,2,3,4-tetrahydronaphthalen-1,4-imine-9-carboxylate

tert-Butyl 4-amino-11-azatricyclo[6.2.1.0,2,7]undeca-2,4,6-triene-11-carboxylate

CAS: 942492-11-7

Versatile small molecule scaffold

Formula: C₁₅H₂₀N₂O₂

Purity: Min. 95%

Molecular weight: 260.33 g/mol

Ref: 3D-SMB49211