CAS 942492-65-1
:2-Chloro-N-ethyl-5-methyl-4-pyrimidinamine
Description:
2-Chloro-N-ethyl-5-methyl-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 2-position and an ethyl group at the nitrogen atom (N-ethyl) contributes to its unique reactivity and solubility properties. The methyl group at the 5-position further modifies its electronic characteristics. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety protocols are followed.
Formula:C7H10ClN3
InChI:InChI=1S/C7H10ClN3/c1-3-9-6-5(2)4-10-7(8)11-6/h4H,3H2,1-2H3,(H,9,10,11)
InChI key:InChIKey=UNWDAUKWILZJFQ-UHFFFAOYSA-N
SMILES:N(CC)C=1C(C)=CN=C(Cl)N1
Synonyms:- 2-Chloro-N-ethyl-5-methyl-4-pyrimidinamine
- 4-Pyrimidinamine, 2-chloro-N-ethyl-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.