CAS 942507-89-3
:4-chloroquinazoline-7-carboxylic acid
Description:
4-Chloroquinazoline-7-carboxylic acid is a heterocyclic organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the 4-position and a carboxylic acid group at the 7-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid functionality, while the aromatic system may enhance its lipophilicity. It is often studied for its biological activity, particularly in the context of drug development, as quinazoline derivatives are known to exhibit a range of pharmacological effects, including anti-cancer and anti-inflammatory properties. The compound's molecular structure allows for various synthetic modifications, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, its unique characteristics make it a subject of interest in research related to targeted therapies and molecular probes in biological systems.
Formula:C9H5ClN2O2
InChI:InChI=1/C9H5ClN2O2/c10-8-6-2-1-5(9(13)14)3-7(6)11-4-12-8/h1-4H,(H,13,14)
SMILES:c1cc2c(cc1C(=O)O)ncnc2Cl
Synonyms:- 7-Quinazolinecarboxylic Acid, 4-Chloro-
- 4-Chloroquinazoline-7-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
