CAS 942519-65-5
:N-Methyl-3-(1-methylethyl)-5-isoxazolemethanamine
Description:
N-Methyl-3-(1-methylethyl)-5-isoxazolemethanamine, identified by its CAS number 942519-65-5, is a chemical compound that features a unique isoxazole ring structure, which contributes to its potential biological activity. This compound is characterized by the presence of a methyl group and an isopropyl group, which can influence its solubility and reactivity. Isoxazoles are known for their diverse pharmacological properties, and the specific substitution pattern in this compound may affect its interaction with biological targets. The presence of the amine functional group suggests potential for hydrogen bonding, which can enhance its affinity for various receptors or enzymes. Additionally, the compound's molecular structure may impart specific physical properties, such as melting point and boiling point, which are essential for understanding its behavior in different environments. Overall, N-Methyl-3-(1-methylethyl)-5-isoxazolemethanamine represents a compound of interest in medicinal chemistry, potentially serving as a lead compound for further drug development.
Formula:C8H14N2O
InChI:InChI=1S/C8H14N2O/c1-6(2)8-4-7(5-9-3)11-10-8/h4,6,9H,5H2,1-3H3
InChI key:InChIKey=BYGUSSATSGHWCD-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C=C(CNC)ON1
Synonyms:- 5-Isoxazolemethanamine, N-methyl-3-(1-methylethyl)-
- (3-Isopropylisoxazol-5-yl)-N-methylmethanamine
- [(3-Isopropylisoxazol-5-yl)methyl]methylamine
- N-Methyl-3-(1-methylethyl)-5-isoxazolemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.