CymitQuimica logo

CAS 942579-56-8

:

8-(bromomethyl)isoquinoline

Description:
8-(Bromomethyl)isoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a bicyclic aromatic system. The presence of a bromomethyl group at the 8-position introduces a bromine atom attached to a methylene (-CH2-) group, enhancing its reactivity and potential for further chemical modifications. This compound typically exhibits properties associated with isoquinolines, such as being a weak base due to the nitrogen atom in the aromatic ring. It is often used in organic synthesis and medicinal chemistry, where the bromomethyl group can serve as a versatile electrophile for nucleophilic substitution reactions. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and conditions, and it is important to handle it with care due to the presence of bromine, which can be hazardous. Overall, 8-(bromomethyl)isoquinoline is a valuable intermediate in the synthesis of various organic compounds.
Formula:C10H8BrN
InChI:InChI=1/C10H8BrN/c11-6-9-3-1-2-8-4-5-12-7-10(8)9/h1-5,7H,6H2
SMILES:c1cc2ccncc2c(c1)CBr
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.